Pyrazolo[1,5-a]pyridine-7-carbaldehyde
Catalog No: FT-0678113
CAS No: 362661-83-4
- Chemical Name: Pyrazolo[1,5-a]pyridine-7-carbaldehyde
- Molecular Formula: C8H6N2O
- Molecular Weight: 146.15
- InChI Key: SGNBVQKSJWCGOJ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6N2O/c11-6-8-3-1-2-7-4-5-9-10(7)8/h1-6H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 146.14600 |
| Density: | 1.24 g/cm3 |
| CAS: | 362661-83-4 |
| Bolling_Point: | N/A |
| Product_Name: | Pyrazolo[1,5-a]pyridine-7-carboxaldehyde |
| Melting_Point: | 83-86ºC |
| Flash_Point: | N/A |
| MF: | C8H6N2O |
| Density: | 1.24 g/cm3 |
|---|---|
| LogP: | 1.14680 |
| Melting_Point: | 83-86ºC |
| FW: | 146.14600 |
| PSA: | 34.37000 |
| MF: | C8H6N2O |
| Exact_Mass: | 146.04800 |
| Warning_Statement: | P280 |
|---|---|
| Safety_Statements: | H302-H315-H317 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)